CAS 342882-77-3
:(5Z,8Z,11Z,14Z)-20-Cyano-N-[(1R)-2-hydroxy-1-methylethyl]-16,16-dimethyl-5,8,11,14-eicosatetraenamide
Description:
The chemical substance known as "(5Z,8Z,11Z,14Z)-20-Cyano-N-[(1R)-2-hydroxy-1-methylethyl]-16,16-dimethyl-5,8,11,14-eicosatetraenamide," with the CAS number 342882-77-3, is a synthetic compound characterized by its complex structure, which includes multiple double bonds and a cyano group. This compound features a long carbon chain, specifically an eicosatetraenamide, indicating it has 20 carbon atoms and four cis double bonds at specified positions. The presence of a cyano group suggests potential reactivity, particularly in nucleophilic reactions. The hydroxyl group attached to a chiral center indicates that the compound may exhibit stereoisomerism, which can influence its biological activity and interactions. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the context of anti-inflammatory or other therapeutic effects. The specific stereochemistry and functional groups contribute to the compound's overall properties, including solubility, reactivity, and biological activity, making it a subject of interest in medicinal chemistry and drug development.
Formula:C26H42N2O2
InChI:InChI=1S/C26H42N2O2/c1-24(23-29)28-25(30)19-15-12-10-8-6-4-5-7-9-11-13-16-20-26(2,3)21-17-14-18-22-27/h4-5,8-11,16,20,24,29H,6-7,12-15,17-19,21,23H2,1-3H3,(H,28,30)/b5-4-,10-8-,11-9-,20-16-/t24-/m1/s1
InChI key:InChIKey=WZQHSBKOWZOASP-QLZKPENWSA-N
SMILES:C(\C(CCCCC#N)(C)C)=C\C/C=C\C/C=C\C/C=C\CCCC(N[C@@H](CO)C)=O
Synonyms:- 5,8,11,14-Eicosatetraenamide, 20-cyano-N-[(1R)-2-hydroxy-1-methylethyl]-16,16-dimethyl-, (5Z,8Z,11Z,14Z)-
- O 1812
- (5Z,8Z,11Z,14Z)-20-Cyano-N-[(1R)-2-hydroxy-1-methylethyl]-16,16-dimethyl-5,8,11,14-eicosatetraenamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
O 1812
CAS:Controlled Product<p>O 1812 is a cannabinoid receptor antagonist. It blocks the binding of cannabinoids to their receptors, thereby inhibiting the effects of cannabinoids. O 1812 has been shown to have therapeutic potential in treating kidney disease, bone growth, and cardiovascular disorders. This drug can also be used in cancer therapy and Alzheimer's disease treatment due to its ability to modulate the activity of certain receptors. O 1812 is a programmable compound that can be configured for specific purposes by adding or removing functional groups from the molecule. The addition of an alkoxy radical group at one end of the molecule allows it to be used as an endpoint marker for DNA sequencing reactions because it fluoresces when excited with ultraviolet light.</p>Purity:Min. 95%Ref: 4Z-A-396003
Discontinued product

