CAS 342899-34-7

3-Amino-2-chloro-4-pyridinecarboxamide

Description:

3-Amino-2-chloro-4-pyridinecarboxamide, with the CAS number 342899-34-7, is a chemical compound that features a pyridine ring substituted with an amino group, a chloro group, and a carboxamide functional group. This compound typically exhibits characteristics common to pyridine derivatives, such as being a polar molecule due to the presence of the amino and carboxamide groups, which can engage in hydrogen bonding. The chloro substituent can influence its reactivity and solubility in various solvents. The presence of the amino group suggests potential basicity, while the carboxamide group may contribute to its stability and ability to participate in various chemical reactions, including nucleophilic substitutions. This compound may be of interest in pharmaceutical research and development due to its potential biological activity, as many pyridine derivatives are known for their roles in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₆H₆ClN₃O

InChI: InChI=1/C6H6ClN3O/c7-5-4(8)3(6(9)11)1-2-10-5/h1-2H,8H2,(H2,9,11)

SMILES: c1cnc(c(c1C(=N)O)N)Cl

Synonyms:

• 3-Amino-2-Chloropyridine-4-Carboxamide

3-Amino-2-chloroisonicotinamide

CAS: 342899-34-7

Formula: C₆H₆ClN₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.5843

Ref: IN-DA007GV9

3-amino-2-chloropyridine-4-carboxamide

CAS: 342899-34-7

3-amino-2-chloropyridine-4-carboxamide

Purity: 97%

Molecular weight: 171.587g/mol

Ref: 54-OR73631

3-Amino-2-chloroisonicotinamide

CAS: 342899-34-7

Formula: C₆H₆ClN₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F064864