CAS 343-21-5
:4-(trifluoromethyl)-10H-phenothiazine
Description:
4-(Trifluoromethyl)-10H-phenothiazine, with the CAS number 343-21-5, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a trifluoromethyl group (-CF3) at the 4-position of the phenothiazine ring, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances the lipophilicity and stability of the molecule, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound exhibits notable biological activity, often being investigated for its potential as an antipsychotic or antimicrobial agent. Additionally, its unique electronic properties due to the trifluoromethyl substituent can affect its interaction with biological targets. In terms of physical properties, it is typically a solid at room temperature, with a specific melting point and solubility characteristics that depend on the solvent used. Overall, 4-(trifluoromethyl)-10H-phenothiazine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C13H8F3NS
InChI:InChI=1/C13H8F3NS/c14-13(15,16)8-4-3-6-10-12(8)18-11-7-2-1-5-9(11)17-10/h1-7,17H
SMILES:c1ccc2c(c1)Nc1cccc(c1S2)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(Trifluoromethyl)-phenothiazine
CAS:Controlled ProductFormula:C13H8F3NSColor and Shape:NeatMolecular weight:267.269

