CAS 343-93-1
:6-fluorogramine
Description:
6-Fluorogramine, identified by its CAS number 343-93-1, is a chemical compound that belongs to the class of fluorinated amines. It is characterized by the presence of a fluorine atom at the 6-position of the gramine structure, which is a bicyclic compound derived from indole. This substitution can influence its chemical reactivity and biological activity. Typically, fluorinated compounds exhibit unique properties such as increased lipophilicity and altered metabolic stability, which can enhance their pharmacological profiles. 6-Fluorogramine may be of interest in medicinal chemistry and drug development due to its potential applications in synthesizing biologically active molecules. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular structure and interactions. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as fluorinated compounds can exhibit varying degrees of biological activity and environmental impact.
Formula:C11H13FN2
InChI:InChI=1/C11H13FN2/c1-14(2)7-8-6-13-11-5-9(12)3-4-10(8)11/h3-6,13H,7H2,1-2H3
SMILES:CN(C)Cc1c[nH]c2cc(ccc12)F
Synonyms:- 1-(6-fluoro-1H-indol-3-yl)-N,N-dimethylmethanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Fluorogramine
CAS:<p>6-Fluorogramine is a synthetic compound that is metabolized by drug-metabolizing enzymes to form 6-fluorohydroxymethyltetrahydrofolate. This intermediate is then hydrolyzed to form 6-hydroxymethyltetrahydrofolate and monohydroxy methylene tetrahydrofolate. The reaction yield for this reaction is about 60%. 6-Fluorohydroxymethyltetrahydrofolate can also be converted to paraformaldehyde and dimethylamine, which are used in the synthesis of other compounds. The positional isomer of 6-fluoromethylenetetrahydropterin (6FMTP) can be synthesized from 6-fluoroformaldehyde and paraformaldehyde.</p>Formula:C11H13FN2Purity:Min. 95%Molecular weight:192.23 g/mol6-Fluorogramine
CAS:<p>6-Fluorogramine is a chemical compound that can be used as a research chemical or as a reagent in the synthesis of other compounds. It is also useful as a building block for complex molecules and fine chemicals. 6-Fluorogramine has been found to be useful in the synthesis of pharmaceuticals, agrochemicals, and organic solvents. It is versatile and can be used as an intermediate or building block in different types of reactions.</p>Formula:C11H13FN2Molecular weight:192.24 g/mol



