CAS 3430-27-1
:3-Amino-4-methylpyridine
Description:
3-Amino-4-methylpyridine is an organic compound characterized by a pyridine ring substituted with an amino group and a methyl group. It has the molecular formula C6H8N2 and features a basic nitrogen atom in the pyridine ring, which contributes to its basicity and potential reactivity. The presence of the amino group (-NH2) enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in polar solvents like water and alcohols. It is used in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, 3-amino-4-methylpyridine can exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and properties make it a valuable compound in various chemical applications.
Formula:C6H8N2
InChI:InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-4H,7H2,1H3
InChI key:InChIKey=IBKMZYWDWWIWEL-UHFFFAOYSA-N
SMILES:CC=1C(N)=CN=CC1
Synonyms:- 3-Amino-4-Picoline
- 3-Amino-4-methyl pyridine
- 3-Amino-γ-picoline
- 3-Pyridinamine, 4-methyl-
- 4-Methyl-3-pyridinamine
- 4-Methylpyridin-3-Amine
- 4-Methylpyridin-3-ylamine
- 4-Picoline, 3-amino-
- Ampic
- 3-Amino-4-methylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Amino-4-methylpyridine
CAS:Formula:C6H8N2Purity:>98.0%(GC)(T)Color and Shape:White to Brown powder to crystalMolecular weight:108.14Ref: IN-DA0033L1
5g25.00€10g27.00€1kg336.00€25g31.00€50g56.00€5kgTo inquire100g68.00€250g129.00€500g181.00€3-Amino-4-methylpyridine
CAS:Formula:C6H8N2Purity:≥ 98.0%Color and Shape:White to off-white or brown crystalline powderMolecular weight:108.143-Amino-4-methylpyridine
CAS:3-Amino-4-methylpyridineFormula:C6H8N2Purity:98%Color and Shape: beige solidMolecular weight:108.14g/mol3-Amino-4-methylpyridine
CAS:Controlled ProductApplications 3-Amino-4-methylpyridine (cas# 3430-27-1) is a compound useful in organic synthesis.
References Huang, H., et al.: Anal. Biochem., 363, 12 (2007), Tucker, T., et al.: J. Med. Chem., 51, 6503 (2008),Formula:C6H8N2Color and Shape:NeatMolecular weight:108.143-Amino-4-methylpyridine
CAS:3-Amino-4-methylpyridine is a chemical compound that belongs to the group of organic compounds. It is used as an intermediate in the synthesis of podophyllotoxin, a cytotoxic agent that inhibits protein synthesis and cell division. 3-Amino-4-methylpyridine binds to mammalian cells with high affinity and inhibits protein synthesis by inhibiting the enzyme ribosomal protein S6 kinase. This compound also has an inhibitory effect on tofacitinib citrate, which is a drug used for treatment of rheumatoid arthritis. 3-Amino-4-methylpyridine has been shown to be effective against chloride ions in its reaction mechanism, making it suitable for use in organic synthesis.Formula:C6H8N2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:108.14 g/mol






