CAS 3432-57-3

1,4,5,8-tetrachloronaphthalene

Description:

1,4,5,8-Tetrachloronaphthalene is a chlorinated aromatic compound characterized by the presence of four chlorine atoms attached to the naphthalene structure at the 1, 4, 5, and 8 positions. This compound typically appears as a solid at room temperature and is known for its stability and resistance to degradation. It is insoluble in water but soluble in organic solvents, which makes it useful in various industrial applications, including as a chemical intermediate and in the production of other chlorinated compounds. The presence of multiple chlorine atoms enhances its hydrophobic properties and can contribute to its bioaccumulation potential in the environment. Additionally, 1,4,5,8-tetrachloronaphthalene may exhibit toxicological effects, necessitating careful handling and regulation due to its potential environmental and health impacts. Its chemical structure allows for various reactions, including nucleophilic substitutions, making it a subject of interest in both synthetic chemistry and environmental studies.

Formula: C₁₀H₄Cl₄

InChI: InChI=1/C10H4Cl4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-4H

Synonyms:

• Naphthalene, 1,4,5,8-tetrachloro