CAS 34320-83-7

5-(4-nitrophenyl)-2-phenyl-1H-pyrazol-3-one

Description:

5-(4-Nitrophenyl)-2-phenyl-1H-pyrazol-3-one, with the CAS number 34320-83-7, is an organic compound characterized by its pyrazolone structure, which features a pyrazole ring substituted with both a nitrophenyl and a phenyl group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can influence its electronic properties and reactivity. It is known for its potential applications in various fields, including pharmaceuticals and dyes, owing to its ability to act as a chromophore. The presence of the nitro group can enhance its reactivity, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a class of pyrazolone derivatives that are of interest for their diverse chemical properties and potential utility in research and industry.

Formula: C₁₅H₁₁N₃O₃

InChI: InChI=1/C15H11N3O3/c19-15-10-14(11-6-8-13(9-7-11)18(20)21)16-17(15)12-4-2-1-3-5-12/h1-10,16H

SMILES: c1ccc(cc1)n1c(=O)cc(c2ccc(cc2)N(=O)=O)[nH]1

3-(4-NITROPHENYL)-1-PHENYL-2-PYRAZOLIN-5-ONE

CAS: 34320-83-7

Formula: C₁₅H₁₁N₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 281.2661

Ref: IN-DA00C0WB

TCS PrP Inhibitor 13

CAS: 34320-83-7

TCS PrP Inhibitor 13

Purity: ≥98%

Molecular weight: 281.27g/mol

Ref: 54-BUP13310

TCS PrP Inhibitor 13

CAS: 34320-83-7

TCS PrP Inhibitor 13 (5-(4-Nitrophenyl)-2-Phenyl-4H-Pyrazol-3-One) is an antiprion agent inhibiting protease-resistant prion protein (PrP-res) accumulation.

Formula: C₁₅H₁₁N₃O₃

Purity: 99.7%

Color and Shape: Solid

Molecular weight: 281.27

Ref: TM-T23450