CymitQuimica logo

CAS 343257-52-3

:

Phenoxazin-5-ium, 3-[(2-carboxyethyl)methylamino]-7-[ethyl(3-sulfopropyl)amino]-, inner salt

Description:
Phenoxazin-5-ium, 3-[(2-carboxyethyl)methylamino]-7-[ethyl(3-sulfopropyl)amino]-, inner salt, identified by CAS number 343257-52-3, is a synthetic organic compound characterized by its complex structure, which includes a phenoxazine core modified with various functional groups. This compound typically exhibits properties such as solubility in polar solvents due to the presence of ionic and polar functional groups, which enhance its interaction with water. The presence of carboxyethyl and sulfopropyl groups suggests potential applications in biological systems, possibly as a dye or in biochemical assays, due to their ability to interact with biomolecules. Additionally, the inner salt formation indicates that the compound may exist in a zwitterionic state, contributing to its stability and solubility. Its unique structure may also impart specific optical properties, making it suitable for use in fluorescence applications. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and potential biomedical applications.
Formula:C21H25N3O6S
InChI:InChI=1S/C21H25N3O6S/c1-3-24(10-4-12-31(27,28)29)16-6-8-18-20(14-16)30-19-13-15(5-7-17(19)22-18)23(2)11-9-21(25)26/h5-8,13-14H,3-4,9-12H2,1-2H3,(H-,25,26,27,28,29)
InChI key:InChIKey=RCTKCVWZEGPPCK-UHFFFAOYSA-N
SMILES:N(CCCS(=O)(=O)O)(CC)C1=CC2=C(N=C3C(=[O+]2)C=C(N(CCC([O-])=O)C)C=C3)C=C1
Synonyms:
  • EVOblue 30
  • Phenoxazin-5-ium, 3-[(2-carboxyethyl)methylamino]-7-[ethyl(3-sulfopropyl)amino]-, inner salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.