CAS 343268-69-9

2-chloro-4,5-dimethyl-pyridine

Description:

2-Chloro-4,5-dimethyl-pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two methyl groups and a chlorine atom. The presence of the chlorine atom at the 2-position and the methyl groups at the 4 and 5 positions contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate polarity, which influences its solubility in various organic solvents. The compound exhibits basic properties due to the nitrogen atom in the pyridine ring, making it a potential ligand in coordination chemistry. Additionally, 2-chloro-4,5-dimethyl-pyridine can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of the electron-withdrawing chlorine atom. Its applications may extend to pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.

Formula: C₇H₈ClN

InChI: InChI=1/C7H8ClN/c1-5-3-7(8)9-4-6(5)2/h3-4H,1-2H3

SMILES: Cc1cc(Cl)ncc1C

Synonyms:

• 2-Chloro-4,5-dimethylpyridine
• Pyridine, 2-Chloro-4,5-Dimethyl-

Pyridine, 2-chloro-4,5-dimethyl- (9CI)

CAS: 343268-69-9

Formula: C₇H₈ClN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 141.5981

Ref: IN-DA00C9SZ

2-Chloro-4,5-dimethylpyridine

CAS: 343268-69-9

2-Chloro-4,5-dimethylpyridine

Purity: 98%

Molecular weight: 141.60g/mol

Ref: 54-OR77627

2-Chloro-4,5-dimethylpyridine

CAS: 343268-69-9

Purity: 98%

Molecular weight: 141.6000061

Ref: 10-F652557

2-Chloro-4,5-dimethylpyridine

Controlled Product

CAS: 343268-69-9

Formula: C₇H₈ClN

Color and Shape: Neat

Molecular weight: 141.598

Ref: TR-C365455