CymitQuimica logo

CAS 3433-15-6

:

5-phenyl-1,3-oxazolidine-2-thione

Description:
5-Phenyl-1,3-oxazolidine-2-thione is a heterocyclic compound characterized by a five-membered ring containing both nitrogen and sulfur atoms. The structure features a phenyl group attached to the oxazolidine ring, which contributes to its aromatic properties. This compound is known for its thione functional group, which can exhibit tautomerism with the corresponding thiol form. It is typically a solid at room temperature and may have a distinct odor. The presence of the oxazolidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Additionally, the compound may exhibit various chemical reactivity patterns, including nucleophilic substitution and cyclization reactions, making it of interest in synthetic organic chemistry. Safety data indicates that, like many sulfur-containing compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 5-phenyl-1,3-oxazolidine-2-thione is a compound of interest for its unique structural features and potential applications in various chemical fields.
Formula:C9H9NOS
InChI:InChI=1/C9H9NOS/c12-9-10-6-8(11-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,10,12)
Synonyms:
  • 5-Phenyl-2-oxazolidinethione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.