CAS 343306-79-6: Org 25969
Description:Org 25969, with the CAS number 343306-79-6, is a chemical compound that belongs to a class of substances known for their specific biological activities. While detailed information on this compound may not be widely available, it is often characterized by its potential applications in pharmaceutical research, particularly in the development of therapeutic agents. Typically, compounds like Org 25969 may exhibit properties such as moderate to high solubility in organic solvents, stability under standard laboratory conditions, and the ability to interact with biological targets, which can lead to desired pharmacological effects. The structure of such compounds usually includes functional groups that facilitate interactions with enzymes or receptors in biological systems. Safety data, including toxicity and environmental impact, would be essential for handling and usage, and should be referenced from reliable sources or safety data sheets. As with any chemical, proper laboratory protocols should be followed to ensure safe handling and experimentation.
Formula:C72H112O48S8·8Na
InChI:InChI=1S/C72H112O48S8.8Na/c73-33(74)1-9-121-17-25-57-41(89)49(97)65(105-25)114-58-26(18-122-10-2-34(75)76)107-67(51(99)43(58)91)116-60-28(20-124-12-4-36(79)80)109-69(53(101)45(60)93)118-62-30(22-126-14-6-38(83)84)111-71(55(103)47(62)95)120-64-32(24-128-16-8-40(87)88)112-72(56(104)48(64)96)119-63-31(23-127-15-7-39(85)86)110-70(54(102)46(63)94)117-61-29(21-125-13-5-37(81)82)108-68(52(100)44(61)92)115-59-27(19-123-11-3-35(77)78)106-66(113-57)50(98)42(59)90;;;;;;;;/h25-32,41-72,89-104H,1-24H2,(H,73,74)(H,75,76)(H,77,78)(H,79,80)(H,81,82)(H,83,84)(H,85,86)(H,87,88);;;;;;;;/t25-,26-,27-,28-,29-,30-,31-,32-,41-,42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-,54-,55?,56?,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-;;;;;;;;/m1......../s1
InChI key:InChIKey=JAHOWADERQMFIV-XLVOIWKQSA-N
SMILES:[Na].O=C(O)CCSCC1OC2OC3C(O)C(O)C(OC3CSCCC(=O)O)OC4C(O)C(O)C(OC4CSCCC(=O)O)OC5C(O)C(O)C(OC5CSCCC(=O)O)OC6C(O)C(O)C(OC6CSCCC(=O)O)OC7C(O)C(O)C(OC7CSCCC(=O)O)OC8C(O)C(O)C(OC8CSCCC(=O)O)OC9C(O)C(O)C(OC9CSCCC(=O)O)OC1C(O)C2O
- Synonyms:
- 6-Per-deoxy-6-per-(2-carboxyethyl)thio-γ-cyclodextrin sodium salt
- Bridion
- Org-25969
- Sugammadex
- Sugammadex Sodium
- Sugammadex sodium salt
- γ-Cyclodextrin, 6<sup>A</sup>,6<sup>B</sup>,6<sup>C</sup>,6<sup>D</sup>,6<sup>E</sup>,6<sup>F</sup>,6<sup>G</sup>,6<sup>H</sup>-octakis-S-(2-carboxyethyl)-6<sup>A</sup>,6<sup>B</sup>,6<sup>C</sup>,6<sup>D</sup>,6<sup>E</sup>,6<sup>F</sup>,6<sup>G</sup>,6<sup>H</sup>-octathio-, octasodium salt
- γ-Cyclodextrin, 6<sup>A</sup>,6<sup>B</sup>,6<sup>C</sup>,6<sup>D</sup>,6<sup>E</sup>,6<sup>F</sup>,6<sup>G</sup>,6<sup>H</sup>-octakis-S-(2-carboxyethyl)-6<sup>A</sup>,6<sup>B</sup>,6<sup>C</sup>,6<sup>D</sup>,6<sup>E</sup>,6<sup>F</sup>,6<sup>G</sup>,6<sup>H</sup>-octathio-, sodium salt (1:8)
- γ-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G,6H-octakis-S-(2-carboxyethyl)-6A,6B,6C,6D,6E,6F,6G,6H-octathio-, sodium salt (1:8)
- γ-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G,6H-octakis-S-(2-carboxyethyl)-6A,6B,6C,6D,6E,6F,6G,6H-octathio-, octasodium salt
- See more synonyms