CAS 343338-29-4

1,5-Anhydro-2-deoxy-3,6-bis-O-[tris(1-methylethyl)silyl]-D-arabino-hex-1-enitol

Description:

1,5-Anhydro-2-deoxy-3,6-bis-O-[tris(1-methylethyl)silyl]-D-arabino-hex-1-enitol is a specialized chemical compound characterized by its unique structural features, including an anhydro sugar backbone and multiple silyl ether groups. The presence of the tris(1-methylethyl)silyl groups enhances its stability and hydrophobicity, making it useful in various chemical applications, particularly in organic synthesis and as a protective group in carbohydrate chemistry. The compound's hex-1-enitol structure indicates the presence of a double bond, which can be reactive under certain conditions, allowing for further functionalization. Additionally, the anhydro sugar configuration suggests potential applications in glycoscience and medicinal chemistry, where modifications to sugar structures can influence biological activity. Its CAS number, 343338-29-4, allows for precise identification in chemical databases, facilitating research and development in fields such as pharmaceuticals and materials science. Overall, this compound exemplifies the complexity and versatility of modified sugar derivatives in chemical research.

Formula: C₂₄H₅₀O₄Si₂

InChI: InChI=1S/C24H50O4Si2/c1-16(2)29(17(3)4,18(5)6)27-15-23-24(25)22(13-14-26-23)28-30(19(7)8,20(9)10)21(11)12/h13-14,16-25H,15H2,1-12H3/t22-,23-,24+/m1/s1

InChI key: InChIKey=YDOYFAHLHUEGEN-SMIHKQSGSA-N

SMILES: [Si](O[C@H]1[C@H](O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC=C1)(C(C)C)(C(C)C)C(C)C

Synonyms:

• 1,5-Anhydro-2-deoxy-3,6-bis-O-[tris(1-methylethyl)silyl]-D-arabino-hex-1-enitol
• D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-3,6-bis-O-[tris(1-methylethyl)silyl]-

3,6-Di-O-triisopropylsilyl-D-glucal

CAS: 343338-29-4

3,6-Di-O-triisopropylsilyl-D-glucal is a synthetic monosaccharide. It has a molecular weight of 368.76 g/mol and chemical formula C14H22O8Si. 3,6-Di-O-triisopropylsilyl-D-glucal is soluble in water and ethanol.
It is used for the synthesis of oligosaccharides and polysaccharides, as well as for modification of sugar moieties on glycoproteins and glycolipids. 3,6-Di-O-triisopropylsilyl-D-glucal can be used for the preparation of complex carbohydrate structures by glycosylation or polysaccharide structures by methylation. 3,6-Di-O-triisopropylsilyl--D--glucal can also be used to synthesize sugar mo

Formula: C₂₄H₅₀O₄Si₂

Purity: Min. 95%

Molecular weight: 458.82 g/mol

Ref: 3D-MD04282