CymitQuimica logo

CAS 34336-93-1

:

63-O-α-D-Glucosylmaltotriose

Description:
63-O-α-D-Glucosylmaltotriose, with the CAS number 34336-93-1, is a complex carbohydrate that belongs to the class of oligosaccharides. It is composed of glucose units linked together, specifically featuring a glucosyl unit attached to a maltotriose structure. This compound is characterized by its glycosidic bonds, which are formed through the condensation of hydroxyl groups from the sugar molecules, resulting in a specific configuration that influences its solubility and reactivity. Typically, oligosaccharides like this one are soluble in water and can exhibit sweet flavors, although their sweetness is generally less intense than that of simple sugars. They play significant roles in biological systems, including serving as energy sources and participating in cell recognition processes. Additionally, such compounds can be utilized in food science and biotechnology for their functional properties, such as prebiotic effects, which promote beneficial gut bacteria. Understanding the structure and properties of 63-O-α-D-Glucosylmaltotriose can provide insights into its potential applications in various fields, including nutrition and pharmaceuticals.
Formula:C24H42O21
InChI:InChI=1S/C24H42O21/c25-1-6(29)11(31)20(7(30)2-26)44-24-19(39)16(36)21(9(4-28)42-24)45-23-18(38)15(35)13(33)10(43-23)5-40-22-17(37)14(34)12(32)8(3-27)41-22/h1,6-24,26-39H,2-5H2/t6-,7+,8+,9+,10+,11+,12+,13+,14-,15-,16+,17+,18+,19+,20+,21+,22-,23+,24+/m0/s1
InChI key:InChIKey=HDKHYSDETIRMHM-CDGFVBQXSA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@H](O[C@@H]([C@@H]([C@H](C=O)O)O)[C@@H](CO)O)[C@H](O)[C@H]1O)[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:
  • 63-α-D-Glucopyranosyl maltotriose
  • 63-α-Glucosylmaltotriose
  • 63-O-α-D-Glucosylmaltotriose
  • D-Glucose, O-α-D-glucopyranosyl-(1→6)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-
  • O-α-D-Glucopyranosyl-(1→6)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-D-glucose
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.