CymitQuimica logo

CAS 3435-29-8

:

4-Pyrimidinamine, 6-phenyl-

Description:
4-Pyrimidinamine, 6-phenyl- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position and a phenyl group (a benzene ring) at the 6-position of the pyrimidine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound may be of interest in various fields, including medicinal chemistry, due to its potential biological activity. Its reactivity can be influenced by the electron-donating and withdrawing effects of the amino and phenyl groups, respectively. Additionally, it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H9N3
InChI:InChI=1/C10H9N3/c11-10-6-9(12-7-13-10)8-4-2-1-3-5-8/h1-7H,(H2,11,12,13)
InChI key:NYXYYBHDSNBGOS-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cc(=N)[nH]cn1
Synonyms:
  • 4-Amino-6-phenylpyrimidine
  • 6-Phenyl-4-pyrimidinamine
  • 6-Phenylpyrimidin-4-Amine
Found 4 products.