CymitQuimica logo

CAS 34366-21-7

:

Pyridine, 3-(2R)-2-piperidinyl-

Description:
Pyridine, 3-(2R)-2-piperidinyl- is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the piperidine moiety indicates that it has a saturated six-membered ring with one nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. This compound is typically colorless to pale yellow and may have a distinct odor. It is soluble in polar solvents, such as water and alcohols, due to the presence of nitrogen, which can engage in dipole interactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various functional group modifications, which can influence its reactivity and interactions with biological targets. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the substituents present. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2/t10-/m1/s1
InChI key:MTXSIJUGVMTTMU-SNVBAGLBSA-N
SMILES:C1CCN[C@H](C1)C2=CN=CC=C2
Found 6 products.