CAS 34366-31-9
:Senegin II
Description:
Senegin II, with the CAS number 34366-31-9, is a chemical compound that belongs to the class of natural products known as alkaloids. It is derived from certain plant species and is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Senegin II has been studied for its potential pharmacological properties, including its effects on the central nervous system and its possible applications in medicinal chemistry. The compound may exhibit various biological activities, such as anti-inflammatory or analgesic effects, although specific mechanisms of action and therapeutic uses are still under investigation. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many alkaloids, safety and toxicity profiles are important considerations in its use, necessitating careful handling and further research to fully understand its potential benefits and risks.
Formula:C70H104O32
InChI:InChI=1S/C70H104O32/c1-29-54(99-58-49(82)45(78)39(27-92-58)97-60-50(83)46(79)43(76)37(25-71)95-60)48(81)52(85)59(93-29)100-56-53(86)55(98-42(75)15-11-31-10-13-35(90-8)36(22-31)91-9)30(2)94-62(56)102-64(89)69-19-18-65(3,4)23-33(69)32-12-14-40-66(5)24-34(74)57(101-61-51(84)47(80)44(77)38(26-72)96-61)68(7,63(87)88)41(66)16-17-67(40,6)70(32,28-73)21-20-69/h10-13,15,22,29-30,33-34,37-41,43-62,71-74,76-86H,14,16-21,23-28H2,1-9H3,(H,87,88)/b15-11+/t29-,30+,33-,34-,37+,38+,39+,40+,41+,43-,44+,45-,46-,47-,48-,49+,50+,51+,52+,53-,54-,55-,56+,57-,58-,59-,60-,61-,62-,66+,67+,68-,69-,70-/m0/s1
InChI key:InChIKey=MNXFXXWQAAMVMW-JEIATDTDSA-N
SMILES:C(O)[C@]12[C@@]3(C)[C@@]([C@]4(C)[C@@](CC3)([C@@](C(O)=O)(C)[C@@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)C4)[H])(CC=C1[C@]6([C@@](C(O[C@H]7[C@H](O[C@H]8[C@H](O)[C@H](O)[C@@H](O[C@H]9[C@H](O)[C@@H](O)[C@H](O[C@@H]%10O[C@H](CO)[C@H](O)[C@H](O)[C@H]%10O)CO9)[C@H](C)O8)[C@@H](O)[C@@H](OC(/C=C/C%11=CC(OC)=C(OC)C=C%11)=O)[C@@H](C)O7)=O)(CC2)CCC(C)(C)C6)[H])[H]
Synonyms:- Olean-12-ene-23,28-dioic acid, 3-(β-D-glucopyranosyloxy)-2,27-dihydroxy-, 28-[O-β-D-galactopyranosyl-(1→4)-O-β-D-xylopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-6-deoxy-4-O-[(2E)-3-(3,4-dimethoxyphenyl)-1-oxo-2-propen-1-yl]-β-D-galactopyranosyl] ester, (2β,3β,4α)-
- Olean-12-ene-23,28-dioic acid, 3-(β-D-glucopyranosyloxy)-2,27-dihydroxy-, 28-[O-β-D-galactopyranosyl-(1→4)-O-β-D-xylopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-6-deoxy-4-O-[(2E)-3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl]-β-D-galactopyranosyl] ester, (2β,3β,4α)-
- Senegin II
- Olean-12-ene-23,28-dioic acid, 3-(β-D-glucopyranosyloxy)-2,27-dihydroxy-, 28-[O-β-D-galactopyranosyl-(1→4)-O-β-D-xylopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-6-deoxy-4-O-[3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl]-β-D-galactopyranosyl] ester, [2β,3β,4α,28(E)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Senegin II
CAS:<p>Senegin II is a saponin compound derived from Polygala senega, which is a perennial herb native to North America. This natural product has garnered scientific interest due to its complex molecular structure and biological activities. Senegin II acts through a multifaceted mode of action, primarily influencing inflammation pathways and modulating cellular responses. Its mechanism involves interacting with cell membranes, altering membrane permeability, and interfering with signal transduction processes related to inflammation.</p>Formula:C70H104O32Purity:Min. 95%Molecular weight:1,457.60 g/mol

