CAS 34367-04-9
:Ginsenoside Ro
Description:
Ginsenoside Ro is a triterpenoid saponin primarily derived from Panax ginseng, a plant known for its medicinal properties. It is characterized by its complex molecular structure, which includes a steroid-like backbone with multiple hydroxyl groups and a sugar moiety, contributing to its solubility and biological activity. Ginsenoside Ro exhibits various pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective properties, making it of interest in both traditional medicine and modern pharmacology. Its mechanism of action often involves modulation of signaling pathways and interaction with various receptors, which can influence cellular processes. Additionally, Ginsenoside Ro has been studied for its potential benefits in enhancing cognitive function and protecting against neurodegenerative diseases. The substance is typically analyzed using techniques such as high-performance liquid chromatography (HPLC) to ensure purity and quantify its concentration in herbal preparations. Overall, Ginsenoside Ro represents a significant compound in the field of natural products and herbal medicine, highlighting the importance of plant-derived substances in therapeutic applications.
Formula:C48H76O19
InChI:InChI=1S/C48H76O19/c1-43(2)14-16-48(42(61)67-40-35(58)31(54)29(52)24(20-50)63-40)17-15-46(6)21(22(48)18-43)8-9-26-45(5)12-11-27(44(3,4)25(45)10-13-47(26,46)7)64-41-37(33(56)32(55)36(65-41)38(59)60)66-39-34(57)30(53)28(51)23(19-49)62-39/h8,22-37,39-41,49-58H,9-20H2,1-7H3,(H,59,60)/t22-,23+,24+,25-,26+,27-,28+,29+,30-,31-,32-,33-,34+,35+,36-,37+,39-,40-,41+,45-,46+,47+,48-/m0/s1
InChI key:InChIKey=NFZYDZXHKFHPGA-QQHDHSITSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@H]7[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O7)CC6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- Chikusetsusaponin 5
- Chikusetsusaponin V
- Ginsenoside Ro
- Ginsenosidero
- Polysciasaponin P<sub>3</sub>
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranosiduronic acid, (3β)-28-(β-<smallcap>D</smallcap>-glucopyranosyloxy)-28-oxoolean-12-en-3-yl 2-O-β-<smallcap>D</span>-glucopyranosyl-
- Polysciasaponin P3
- β-D-Glucopyranosiduronic acid, (3β)-28-(β-D-glucopyranosyloxy)-28-oxoolean-12-en-3-yl 2-O-β-D-glucopyranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Ginsenoside Ro
CAS:<p>Ginsenoside Ro (Chikusetsusaponin V) can reduce TXA2 production, weakly reduce COX-1 and TXAS activities, and has antiplatelet effects as a Ca2+ antagonist with</p>Formula:C48H76O19Purity:98% - 99.66%Color and Shape:SolidMolecular weight:957.11Ginsenoside Ro
CAS:Formula:C48H76O19Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:957.13Ginsenoside ro
CAS:Natural glycosideFormula:C48H76O19Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:957.12Ginsenoside Ro
CAS:<p>Ginsenoside Ro is a triterpenoid saponin, which is a secondary metabolite found primarily in Panax ginseng. This compound is isolated from the roots of the ginseng plant, a source well-documented for its rich array of bioactive constituents. Ginsenoside Ro functions through various biochemical pathways, including modulating inflammatory signaling cascades and exhibiting antioxidant activity. It interacts with molecular targets such as enzymes and receptors involved in the inflammatory response, thereby exerting its effects on cellular processes.</p>Formula:C48H76O19Purity:Min. 95%Color and Shape:PowderMolecular weight:957.13 g/mol
