CAS 34367-55-0

1-methyl-L-histidyl-N-{[(2S)-5-oxopyrrolidin-2-yl]carbonyl}-L-prolinamide

Description:

1-Methyl-L-histidyl-N-{[(2S)-5-oxopyrrolidin-2-yl]carbonyl}-L-prolinamide, with the CAS number 34367-55-0, is a synthetic compound that belongs to the class of peptides. It features a unique structure that includes a modified histidine residue, a proline moiety, and a pyrrolidine ring, which contributes to its potential biological activity. The presence of the methyl group on the histidine side chain can influence its interaction with biological targets, potentially enhancing its stability and solubility. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of peptide-based therapeutics. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the conditions under which it is studied. Additionally, the compound's biological activity would need to be evaluated through experimental studies to determine its efficacy and safety in potential applications. Overall, this compound represents an interesting area of research in peptide chemistry and drug design.

Formula: C₁₇H₂₄N₆O₄

InChI: InChI=1/C17H24N6O4/c1-22-8-10(19-9-22)7-11(18)17(27)23-6-2-3-13(23)16(26)21-15(25)12-4-5-14(24)20-12/h8-9,11-13H,2-7,18H2,1H3,(H,20,24)(H,21,25,26)/t11-,12-,13-/m0/s1

SMILES: Cn1cc(C[C@@H](C(=O)N2CCC[C@H]2C(=O)N=C([C@@H]2CCC(=N2)O)O)N)nc1

(His(1-Me)2)-TRH Pyr-His(1-Me)-Pro-NH2

CAS: 34367-55-0

Please enquire for more information about (His(1-Me)2)-TRH Pyr-His(1-Me)-Pro-NH2 including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₄N₆O₄

Purity: Min. 95%

Molecular weight: 376.41 g/mol

Ref: 3D-FH110205