
CAS 3437-28-3
:3-Azabicyclo[3.2.2]nonane-3-propanamine
Description:
3-Azabicyclo[3.2.2]nonane-3-propanamine, with the CAS number 3437-28-3, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within the ring system. This compound features a propanamine side chain, which contributes to its potential as a building block in medicinal chemistry and organic synthesis. The bicyclic framework provides rigidity, which can influence the compound's biological activity and interaction with various receptors. Typically, such compounds may exhibit properties relevant to neuropharmacology, as they can interact with neurotransmitter systems. The presence of the amine functional group suggests that it may participate in hydrogen bonding, affecting its solubility and reactivity. Additionally, the stereochemistry of the compound can play a crucial role in its pharmacological properties, making it a subject of interest in drug design and development. Overall, 3-Azabicyclo[3.2.2]nonane-3-propanamine is notable for its structural complexity and potential applications in various fields of chemistry and pharmacology.
Formula:C11H22N2
InChI:InChI=1S/C11H22N2/c12-6-1-7-13-8-10-2-3-11(9-13)5-4-10/h10-11H,1-9,12H2
InChI key:InChIKey=URQQMKMRBDWFAW-UHFFFAOYSA-N
SMILES:C(CCN)N1CC2CCC(C1)CC2
Synonyms:- 3-(3-Aminopropyl)-3-azabicyclo[3.2.2]nonane
- 3-Azabicyclo[3.2.2]nonane, 3-(3-aminopropyl)-
- 3-(3-Azabicyclo[3.2.2]non-3-yl)propylamine
- 3-Azabicyclo[3.2.2]nonane-3-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.