CymitQuimica logo

CAS 3437-29-4

:

3,3-dimethylpyrrolidine-2,5-dione

Description:
3,3-Dimethylpyrrolidine-2,5-dione, also known as DMPO, is a cyclic compound characterized by its five-membered ring structure containing both nitrogen and carbon atoms. It features two carbonyl groups (C=O) at the 2 and 5 positions of the pyrrolidine ring, contributing to its diketone nature. The presence of two methyl groups at the 3 position enhances its steric bulk and influences its reactivity. This compound is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. DMPO is known for its role in organic synthesis and as a precursor in the production of various pharmaceuticals and agrochemicals. Its unique structure allows it to participate in various chemical reactions, including cycloadditions and condensation reactions. Additionally, it has applications in the field of spin trapping in electron paramagnetic resonance (EPR) spectroscopy, where it is used to stabilize free radicals for analysis. Safety precautions should be observed when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.
Formula:C6H9NO2
InChI:InChI=1/C6H9NO2/c1-6(2)3-4(8)7-5(6)9/h3H2,1-2H3,(H,7,8,9)
InChI key:JVQHRYVXOWBSNS-UHFFFAOYSA-N
SMILES:CC1(C)CC(=NC1=O)O
Found 5 products.