CAS 34371-14-7
:2-Deoxy-D-ribono-1,4-lactone
Description:
2-Deoxy-D-ribono-1,4-lactone is a chemical compound that plays a significant role in carbohydrate chemistry and biochemistry. It is a lactone derived from 2-deoxy-D-ribose, a sugar that is a component of nucleic acids. This compound is characterized by its cyclic structure, which includes a five-membered ring formed by the reaction of the hydroxyl group on the sugar with the carbonyl group, resulting in a lactone. It is typically a white to off-white solid and is soluble in water due to the presence of hydroxyl groups. The compound is important in various biochemical pathways, particularly in the metabolism of nucleotides and nucleic acids. Its reactivity can be attributed to the presence of functional groups that can participate in further chemical reactions, making it a valuable intermediate in organic synthesis. Additionally, its stereochemistry is crucial for its biological activity, influencing interactions with enzymes and other biomolecules. Overall, 2-Deoxy-D-ribono-1,4-lactone is a significant compound in both synthetic and biological contexts.
Formula:C5H8O4
InChI:InChI=1/C5H8O4/c6-2-4-3(7)1-5(8)9-4/h3-4,6-7H,1-2H2/t3-,4+/m0/s1
InChI key:InChIKey=YIXDEYPPAGPYDP-IUYQGCFVSA-N
SMILES:C(O)[C@@H]1[C@@H](O)CC(=O)O1
Synonyms:- D-erythro-Pentonic acid, 2-deoxy-, γ-lactone
- 2-Deoxy-D-erythro-pentono-γ-lactone
- 2-Deoxy-D-ribonolactone
- 2-Deoxy-D-ribono-1,4-lactone
- 2′-Deoxyribolactone
- 2-Deoxy-D-ribonic acid-1,4-lactone
- 2,4,5-trihydroxypentanoic acid gamma-lactone
- 2-Deoxy-D-ribono-1,4-lactone >=95% (GC)
- (4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-one
- (4S,5R)-4-hydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one (non-preferred name)
- 2-Deoxy-D-ribonic acid γ-lactone
- 2'-Deoxyribonolactone
- 2-Deoxy-D-ribonic-1,4-lactone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Deoxy-D-ribonic-1,4-lactone
CAS:Formula:C5H8O4Purity:97%Color and Shape:LiquidMolecular weight:132.1146Ref: IN-DA00C0Q3
25gTo inquire100gTo inquire500gTo inquire100mg39.00€250mg51.00€1g123.00€5g209.00€10g325.00€2-Deoxy-D-ribonic-1,4-lactone
CAS:2-Deoxy-D-ribonic-1,4-lactone((4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-one) is used in organic synthesis and biochemical experiments.Formula:C5H8O4Purity:99.83%Color and Shape:SolidMolecular weight:132.12(4S,5R)-4-Hydroxy-5-(Hydroxymethyl)Dihydrofuran-2(3H)-One
CAS:(4S,5R)-4-Hydroxy-5-(Hydroxymethyl)Dihydrofuran-2(3H)-OnePurity:97%Molecular weight:132.11g/mol2-Deoxy-D-ribonic acid-1,4-lactone
CAS:2-Deoxy-D-ribonic acid-1,4-lactone (2DRA) is a chemical compound with physiological effects. 2DRA is an irreversible inhibitor of DNA polymerase that has been shown to be a potent inhibitor of nuclear DNA synthesis in vitro and in vivo. The 2DRA inhibits the transfer reactions that are required for the replication of DNA. 2DRA binds to the nuclease domain of the enzyme and prevents it from cutting the phosphodiester bonds, leading to inhibition of DNA synthesis. This compound also has genotoxic effects and can cause mutation in cells through radiation or chemical treatment.Formula:C5H8O4Purity:Min. 95%Color and Shape:Colorless Yellow PowderMolecular weight:132.12 g/mol(4S,5R)-4-HYDROXY-5-(HYDROXYMETHYL)DIHYDROFURAN-2(3H)-ONE
CAS:Formula:C5H8O4Purity:97%Color and Shape:Liquid, ViscousMolecular weight:132.115







