CAS 34374-67-9

5,6-dichloro-2H-benzotriazole

Description:

5,6-Dichloro-2H-benzotriazole is an organic compound characterized by its triazole ring structure, which is fused to a benzene ring. This compound features two chlorine atoms substituted at the 5 and 6 positions of the benzotriazole moiety, contributing to its unique chemical properties. It is typically a white to light yellow crystalline solid, exhibiting moderate solubility in organic solvents such as acetone and ethanol, but limited solubility in water. The presence of chlorine atoms enhances its reactivity and stability, making it useful in various applications, including as a corrosion inhibitor and in the formulation of antifouling agents. Additionally, 5,6-dichloro-2H-benzotriazole is known for its UV-absorbing properties, which makes it valuable in protecting materials from photodegradation. Safety considerations are important, as it may pose environmental and health risks, necessitating proper handling and disposal measures. Overall, this compound is significant in both industrial and research contexts due to its versatile chemical behavior and protective qualities.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-3-1-5-6(2-4(3)8)10-11-9-5/h1-2H,(H,9,10,11)

SMILES: c1c(c(cc2c1nn[nH]2)Cl)Cl

Synonyms:

• 5,6-Dichloro-2H-benzotriazole
• 5,6-Dichloro-1H-1,2,3-benzotriazole
• 1H-Benzotriazole, 5,6-dichloro-
• 5,6-Dichlorobenzotriazole

5,6-Dichloro-1H-1,2,3-benzotriazole

CAS: 34374-67-9

Versatile small molecule scaffold

Formula: C₆H₃Cl₂N₃

Purity: Min. 95%

Molecular weight: 188.01 g/mol

Ref: 3D-JBA37467