CymitQuimica logo

CAS 34374-88-4

:

2,4,6-Triformylphloroglucinol

Description:
2,4,6-Triformylphloroglucinol, with the CAS number 34374-88-4, is a chemical compound characterized by its three formyl (aldehyde) groups attached to a phloroglucinol backbone. This compound is typically a white to light yellow solid and is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic nature. It exhibits notable reactivity due to the presence of multiple aldehyde functional groups, making it useful in various chemical reactions, including condensation and polymerization processes. 2,4,6-Triformylphloroglucinol is often employed in the synthesis of complex organic molecules and materials, including polymers and coordination compounds. Its unique structure allows for potential applications in fields such as materials science, organic synthesis, and medicinal chemistry. Additionally, it may exhibit interesting optical and electronic properties, which can be explored for applications in sensors and other advanced materials. As with any chemical substance, proper handling and safety precautions should be observed due to its reactive nature.
Formula:C9H6O6
InChI:InChI=1S/C9H6O6/c10-1-4-7(13)5(2-11)9(15)6(3-12)8(4)14/h1-3,13-15H
InChI key:KAPNIDMXEKQLMQ-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C(=C(C(=C1O)C=O)O)C=O)O
Synonyms:
  • 2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde
  • 1,3,5-Benzenetricarboxaldehyde, 2,4,6-trihydroxy-
  • MOP
  • 2,4,6-Trihydroxy-1,3,5-benzenetricarbaldehyde
  • 1,3,5-Benzenetricarboxaldehyde,2,4,6-trihydroxy-
  • Trialdehyde Resorcinol
Found 8 products.