CymitQuimica logo

CAS 343770-23-0

:

Fmoc-Orn(Mtt)-OH

Description:
Fmoc-Orn(Mtt)-OH, with the CAS number 343770-23-0, is a chemical compound commonly used in peptide synthesis and research. It is a derivative of ornithine, an amino acid, and features a fluorenylmethyloxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis to protect the amino group during the coupling reactions. The compound also contains a 4-methyltrityl (Mtt) group, which protects the side chain of ornithine, allowing for selective deprotection at specific stages of synthesis. Fmoc-Orn(Mtt)-OH is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). Its stability under standard laboratory conditions makes it a valuable intermediate in the synthesis of peptides and other bioactive molecules. The careful manipulation of its protective groups allows for the precise assembly of complex peptide structures, facilitating advancements in drug development and biochemical research.
Formula:C40H38N2O4
InChI:InChI=1S/C40H38N2O4/c1-28-22-24-31(25-23-28)40(29-13-4-2-5-14-29,30-15-6-3-7-16-30)41-26-12-21-37(38(43)44)42-39(45)46-27-36-34-19-10-8-17-32(34)33-18-9-11-20-35(33)36/h2-11,13-20,22-25,36-37,41H,12,21,26-27H2,1H3,(H,42,45)(H,43,44)/t37-/m0/s1
InChI key:RRYSGISHZIBOJC-QNGWXLTQSA-N
SMILES:CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46
Found 4 products.