CymitQuimica logo

CAS 34378-65-9

:

dimethyl N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-L-glutamate

Description:
Dimethyl N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-L-glutamate, identified by its CAS number 34378-65-9, is a chemical compound that features a complex structure incorporating both amino acid and pteridine moieties. This substance is characterized by its dual functionality, as it contains both a glutamate residue and a pteridine derivative, which may contribute to its biological activity. The presence of dimethyl groups suggests enhanced lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound is likely to exhibit interactions with biological targets, possibly related to its role in cellular processes or as a pharmacological agent. Its structural features may also suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific pathways. As with many compounds of this nature, understanding its stability, reactivity, and biological interactions would be crucial for further applications in research or clinical settings.
Formula:C22H26N8O5
InChI:InChI=1/C22H26N8O5/c1-30(11-13-10-25-19-17(26-13)18(23)28-22(24)29-19)14-6-4-12(5-7-14)20(32)27-15(21(33)35-3)8-9-16(31)34-2/h4-7,10,15H,8-9,11H2,1-3H3,(H,27,32)(H4,23,24,25,28,29)/t15-/m0/s1
SMILES:CN(Cc1cnc2c(c(N)[nH]c(=N)n2)n1)c1ccc(cc1)C(=O)N[C@@H](CCC(=O)OC)C(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.