CAS 3438-16-2
:5-Chloro-2-methoxybenzoic acid
Description:
5-Chloro-2-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a chloro group and a methoxy group on a benzoic acid framework. Its molecular structure features a benzene ring substituted at the 5-position with a chlorine atom and at the 2-position with a methoxy group (-OCH3), along with a carboxylic acid group (-COOH) that is typical of benzoic acids. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits moderate acidity, typical of carboxylic acids, and can participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of the chloro and methoxy substituents can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, its CAS number, 3438-16-2, allows for easy identification in chemical databases and literature.
Formula:C8H7ClO3
InChI:InChI=1S/C8H7ClO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=HULDRQRKKXRXBI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C=CC(Cl)=C1
Synonyms:- 2-Methoxy-5-chlorobenzoic acid
- 5-Chloro-2-Methoxybenzoate
- 5-Chloro-2-Methoxybenzoic Acid
- 5-Chloro-o-anisic acid (COOH=1)
- Benzoic acid, 5-chloro-2-methoxy-
- o-Anisic acid, 5-chloro-
- 5-Chloro-o-anisic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
5-Chloro-2-methoxybenzoic Acid
CAS:Formula:C8H7ClO3Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:186.595-Chloro-2-methoxybenzoic acid
CAS:Formula:C8H7ClO3Purity:95%Color and Shape:SolidMolecular weight:186.59245-Chloro-2-methoxybenzoic acid
CAS:5-Chloro-2-methoxybenzoic acidPurity:≥98%Molecular weight:186.59g/mol5-Chloro-2-methoxybenzoic Acid
CAS:Controlled ProductFormula:C8H7ClO3Color and Shape:NeatMolecular weight:186.595-Chloro-2-methoxybenzoic acid
CAS:5-Chloro-2-methoxybenzoic acid is a pharmaceutical intermediate.Formula:C8H7ClO3Purity:99.67%Color and Shape:White To Off-White Crystalline PowderMolecular weight:186.595-Chloro-2-methoxybenzoic acid
CAS:5-Chloro-2-methoxybenzoic acidFormula:C8H7ClO3Purity:98%Color and Shape: white powderMolecular weight:186.59g/mol5-Chloro-2-methoxybenzoic acid
CAS:5-Chloro-2-methoxybenzoic acid is an industrial chemical that is used in the production of pharmaceuticals, plastics, and dyes. It also has hypoglycemic activity and can be used to treat type 2 diabetes. The molecular modeling study of this compound showed that it binds to the chloride ion by forming a hydrogen bond between the oxygen atom of the carboxylic acid group and the nitrogen atom of the chloride ion. This interaction leads to a lower pH value in the environment where 5-chloro-2-methoxybenzoic acid is present. This change in pH may affect other molecules such as glucose, which could lead to a decrease in blood sugar levels. Researchers have found that 5-chloro-2-methoxybenzoic acid has cancer cell growth inhibiting properties and can be used as a potential drug for colorectal adenocarcinoma treatment.Formula:C8H7ClO3Purity:Min. 95%Molecular weight:186.59 g/mol5-Chloro-2-methoxybenzoic acid
CAS:Formula:C8H7ClO3Purity:95%Color and Shape:Off-white powderMolecular weight:186.595-Chloro-2-methoxybenzoic Acid
CAS:Controlled ProductFormula:C8H7ClO3Color and Shape:NeatMolecular weight:186.59Ref: 4Z-G-1310
Discontinued product










