CAS 3438-55-9

5-bromo-4-chloro-6-methylpyrimidine

Description:

5-Bromo-4-chloro-6-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with bromine, chlorine, and a methyl group. The presence of these halogen atoms and a methyl group contributes to its unique reactivity and properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents. It is often used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The halogen substituents can enhance the compound's biological activity and influence its interaction with biological targets. Additionally, the presence of multiple functional groups allows for further derivatization, making it a valuable building block in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and disposal methods should be followed to mitigate environmental impact.

Formula: C₅H₄BrClN₂

InChI: InChI=1/C5H4BrClN2/c1-3-4(6)5(7)9-2-8-3/h2H,1H3

SMILES: Cc1c(c(Cl)ncn1)Br

Synonyms:

• Pyrimidine, 5-Bromo-4-Chloro-6-Methyl-
• 5-Bromo-4-chloro-6-methylpyrimidine

5-Bromo-4-chloro-6-methylpyrimidine

CAS: 3438-55-9

Formula: C₅H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.4557

Ref: IN-DA003MJ5

5-Bromo-4-chloro-6-methylpyrimidine

CAS: 3438-55-9

5-Bromo-4-chloro-6-methylpyrimidine

Purity: 96%

Molecular weight: 207.46g/mol

Ref: 54-OR73390

5-Bromo-4-chloro-6-methylpyrimidine

CAS: 3438-55-9

Formula: C₅H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.46

Ref: 10-F077009