
CAS 3438-56-0
:5-Bromo-4-chloro-6-phenylpyrimidine
Description:
5-Bromo-4-chloro-6-phenylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with bromine, chlorine, and a phenyl group. The presence of these halogen substituents can influence the compound's reactivity and solubility, making it of interest in various chemical applications, particularly in medicinal chemistry and material science. The bromine and chlorine atoms introduce electrophilic sites, which can participate in further chemical reactions, such as nucleophilic substitutions or coupling reactions. The phenyl group enhances the compound's lipophilicity, potentially affecting its biological activity and interaction with biological targets. This compound may exhibit properties such as antimicrobial or antitumor activity, making it a candidate for drug development. Additionally, its structural features allow for potential applications in the synthesis of more complex organic molecules. As with many halogenated compounds, care should be taken regarding its environmental impact and handling due to the potential toxicity associated with halogenated organic substances.
Formula:C10H6BrClN2
InChI:InChI=1S/C10H6BrClN2/c11-8-9(13-6-14-10(8)12)7-4-2-1-3-5-7/h1-6H
InChI key:InChIKey=WVUYMEHUPXATFE-UHFFFAOYSA-N
SMILES:BrC=1C(=NC=NC1Cl)C2=CC=CC=C2
Synonyms:- Pyrimidine, 5-bromo-4-chloro-6-phenyl-
- 5-Bromo-4-chloro-6-phenylpyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.