CymitQuimica logo

CAS 343855-83-4

:

methyl 2-amino-5-propylthiophene-3-carboxylate

Description:
Methyl 2-amino-5-propylthiophene-3-carboxylate is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an amino group (-NH2) and a carboxylate group (-COOCH3) that contribute to its reactivity and solubility properties. The presence of the propyl group enhances its hydrophobic characteristics, influencing its interaction with biological systems and solvents. Methyl 2-amino-5-propylthiophene-3-carboxylate may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for potential hydrogen bonding and interactions with various biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique combination of functional groups and structural features that may be leveraged in various chemical and biological applications.
Formula:C9H13NO2S
InChI:InChI=1/C9H13NO2S/c1-3-4-6-5-7(8(10)13-6)9(11)12-2/h5H,3-4,10H2,1-2H3
InChI key:MPMLOEOVNAKTOS-UHFFFAOYSA-N
SMILES:CCCc1cc(c(N)s1)C(=O)OC
Synonyms:
  • 3-Thiophenecarboxylic Acid, 2-Amino-5-Propyl-, Methyl Ester
Found 2 products.