CAS 34392-63-7
:4-Amino-N-(3,4-dichlorophenyl)benzenesulfonamide
Description:
4-Amino-N-(3,4-dichlorophenyl)benzenesulfonamide, with the CAS number 34392-63-7, is a sulfonamide compound characterized by the presence of an amino group and a sulfonamide functional group attached to a benzene ring. This compound features a dichlorophenyl substituent, which contributes to its chemical properties and potential biological activity. Typically, sulfonamides are known for their antibacterial properties, as they inhibit bacterial growth by interfering with folic acid synthesis. The presence of chlorine atoms in the structure can enhance the compound's lipophilicity and influence its pharmacokinetic properties. In terms of physical characteristics, sulfonamides often exhibit moderate solubility in water and may have varying melting points depending on their specific structure. This compound may be of interest in pharmaceutical research and development, particularly in the context of designing new antimicrobial agents or studying their mechanisms of action. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C12H10Cl2N2O2S
InChI:InChI=1S/C12H10Cl2N2O2S/c13-11-6-3-9(7-12(11)14)16-19(17,18)10-4-1-8(15)2-5-10/h1-7,16H,15H2
InChI key:InChIKey=CDCMAMVXGZBIAX-UHFFFAOYSA-N
SMILES:S(NC1=CC(Cl)=C(Cl)C=C1)(=O)(=O)C2=CC=C(N)C=C2
Synonyms:- 4-Amino-N-(3,4-dichlorophenyl)benzenesulfonamide
- Benzenesulfonamide, 4-amino-N-(3,4-dichlorophenyl)-
- Sulfanilanilide, 3′,4′-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
