CymitQuimica logo

CAS 343925-95-1

:

2-Amino-3-pentanone

Description:
2-Amino-3-pentanone, with the CAS number 343925-95-1, is an organic compound characterized by the presence of both an amino group (-NH2) and a ketone functional group (C=O) within a five-carbon chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in water and various organic solvents, which is indicative of its polar nature due to the amino and carbonyl groups. The presence of the amino group allows for potential interactions such as hydrogen bonding, making it a versatile intermediate in organic synthesis. 2-Amino-3-pentanone can be used in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its reactivity is influenced by both the amino and ketone functionalities, allowing it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H11NO
InChI:InChI=1S/C5H11NO/c1-3-5(7)4(2)6/h4H,3,6H2,1-2H3
InChI key:InChIKey=QFQPULHETHXBCL-UHFFFAOYSA-N
SMILES:C(C(C)N)(CC)=O
Synonyms:
  • 3-Pentanone, 2-amino-
  • 2-Amino-3-pentanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.