CAS 34395-01-2
:(2S,3R,4S,5R,6R)-2-{[(1S,2S,3R,4R,5S)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]oct-2-yl]oxy}-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol (non-preferred name)
Description:
The chemical substance with the name "(2S,3R,4S,5R,6R)-2-{[(1S,2S,3R,4R,5S)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]oct-2-yl]oxy}-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol" and CAS number "34395-01-2" is a complex organic compound characterized by multiple stereocenters, indicating its chiral nature. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and contains several hydroxyl (-OH) groups that contribute to its hydrophilicity and potential reactivity. The presence of a bicyclic structure suggests it may exhibit unique conformational properties and interactions. This compound is likely to be soluble in polar solvents due to its hydroxyl groups, and its stereochemistry may influence its biological activity, making it of interest in medicinal chemistry. The specific arrangement of functional groups and stereochemistry can significantly affect its properties, including its melting point, boiling point, and reactivity with other chemical species. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of natural product synthesis and modification.
Formula:C12H20O10
InChI:InChI=1/C12H20O10/c13-1-3-5(14)6(15)8(17)12(20-3)22-10-4-2-19-11(21-4)9(18)7(10)16/h3-18H,1-2H2/t3-,4+,5+,6+,7-,8-,9-,10-,11+,12+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,6-Anhydro-4-O-b-D-galactopyranosyl-b-D-glucopyranose
CAS:N-acetyllactosamine is a monosaccharide that belongs to the group of n-acetyllactosamine. It can be found in the form of an agglutinin, lactose, and lectin. The conformation of this molecule is an equilibrium between its alpha and beta forms. The pyridine can act as an acid catalyst for the alpha conformation. There are two forms of this molecule: one synthesized from D-glucose and one synthesized from D-galactose. 1,6-Anhydro-4-O-b-D-galactopyranosyl-b-D-glucopyranose is synthesized from D-glucose. Oligosaccharides containing this molecule have been expressed in Saccharomyces cerevisiae cells and purified by affinity chromatography on columns that contain immobilized antibody to human serum albumin. This molecule has been shownFormula:C12H20O10Purity:Min. 95%Molecular weight:324.28 g/mol


