CAS 34395-24-9
:3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl 2-propenoate
Description:
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl 2-propenoate, with CAS number 34395-24-9, is a fluorinated organic compound characterized by its long carbon chain and multiple fluorine substituents. This compound features a polymerizable vinyl group (2-propenoate) that allows it to participate in various polymerization reactions, making it useful in the synthesis of fluorinated polymers. The presence of numerous fluorine atoms imparts unique properties, such as increased hydrophobicity and chemical stability, which can enhance the performance of materials in applications like coatings, surfactants, and specialty polymers. Additionally, the compound's structure suggests potential uses in fields requiring low surface energy materials, such as anti-fogging agents or non-stick coatings. However, the environmental and health impacts of fluorinated compounds are subjects of ongoing research, given their persistence and potential bioaccumulation. Proper handling and disposal measures are essential when working with such substances to mitigate any risks associated with their use.
Formula:C17H7F25O2
InChI:InChI=1S/C17H7F25O2/c1-2-5(43)44-4-3-6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)12(30,31)13(32,33)14(34,35)15(36,37)16(38,39)17(40,41)42/h2H,1,3-4H2
InChI key:InChIKey=SWTZSHBOMGAQKX-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(CCOC(C=C)=O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 2-(Perfluorododecyl)ethyl acrylate
- 2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecyl ester
- 251-992-9
- 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl 2-propenoate
- 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl Prop-2-Enoate
- Acrylic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecyl ester
- Perfluorododecylethyl acrylate
- 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl acrylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(Perfluorododecyl)ethyl acrylate
CAS:<p>2-(Perfluorododecyl)ethyl acrylate (FDAE) is a reactive monomer that belongs to the group of methacrylates. It is a colorless, dry powder with a low viscosity. FDAE has hydrophobic properties and a low molecular weight, which makes it suitable for use in coatings and adhesives. This product may be used in the production of polymers, plastics, elastomers, fibers, and rubber products. FDAE can be used as an additive to improve the surface properties of polymers and plastics or as a coating to prevent corrosion. It can also be used as a plasticizer for thermoplastics such as PVC. FDAE reacts with fluorine or chloride ions in the environment, forming highly crosslinkable compounds that are resistant to degradation by sunlight or weathering.</p>Formula:C17H7F25O2Purity:Min. 95%Color and Shape:PowderMolecular weight:718.2 g/mol
