CAS 34397-00-7
:3-(6-oxo-3,6-dihydro-9H-purin-9-yl)propanoic acid
Description:
3-(6-oxo-3,6-dihydro-9H-purin-9-yl)propanoic acid, with the CAS number 34397-00-7, is a chemical compound that features a purine derivative structure. This substance is characterized by the presence of a propanoic acid moiety attached to a purine ring, specifically a 6-oxo-3,6-dihydro-9H-purine. The purine structure is known for its role in biological systems, particularly in nucleic acids like DNA and RNA. The compound exhibits both acidic and basic properties due to the carboxylic acid group, which can donate protons in solution. It may participate in various biochemical pathways and could have implications in medicinal chemistry, particularly in the development of pharmaceuticals targeting purine metabolism. Additionally, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique intersection of organic chemistry and biochemistry, with potential applications in research and drug development.
Formula:C8H8N4O3
InChI:InChI=1/C8H8N4O3/c13-5(14)1-2-12-4-11-6-7(12)9-3-10-8(6)15/h3-4H,1-2H2,(H,13,14)(H,9,10,15)
SMILES:C(Cn1cnc2c1ncnc2O)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
7N-[1-(2-Carboxy)ethyl]allopurinol
CAS:Formula:C8H8N4O3Color and Shape:SolidMolecular weight:208.17417N-[1-(2-Carboxy)ethyl]allopurinol
CAS:Controlled ProductApplications 7N-[1-(2-Carboxy)ethyl]allopurinol (cas# 34397-00-7) is a compound useful in organic synthesis.
Formula:C8H8N4O3Color and Shape:NeatMolecular weight:208.17

