CAS 344-16-1

1-Bromo-2-fluoro-3,5-dimethylbenzene

Description:

1-Bromo-2-fluoro-3,5-dimethylbenzene, also known as 1-bromo-2-fluoro-m-xylene, is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and two methyl groups on a benzene ring. The molecular structure features a bromine substituent at the first position and a fluorine substituent at the second position, with two methyl groups located at the third and fifth positions of the benzene ring. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is moderately soluble in organic solvents and exhibits low solubility in water. The presence of halogen atoms (bromine and fluorine) contributes to its reactivity, making it useful in various chemical synthesis applications, including the production of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point and melting point, are influenced by the steric effects of the methyl groups and the electronegativity of the halogens. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₈H₈BrF

InChI: InChI=1/C8H8BrF/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,1-2H3

SMILES: Cc1cc(C)c(c(c1)Br)F

Synonyms:

• Benzene, 1-bromo-2-fluoro-3,5-dimethyl-
• 6-Bromo-1-fluoro-2,4-dimethylbenzene
• 1-Bromo-3,5-dimethyl-2-fluorobenzene

1-Bromo-2-fluoro-3,5-dimethylbenzene

CAS: 344-16-1

Formula: C₈H₈BrF

Purity: 97%

Color and Shape: Liquid

Molecular weight: 203.0515

Ref: IN-DA007FPH

5-Bromo-4-fluoro-m-xylene

CAS: 344-16-1

Formula: C₈H₈BrF

Purity: 97%

Color and Shape: Liquid

Molecular weight: 203.054

Ref: 10-F037657