CAS 344-19-4: 2,6-Dichloro-4-fluorobenzenamine

Description:2,6-Dichloro-4-fluorobenzenamine, with the CAS number 344-19-4, is an aromatic amine characterized by the presence of two chlorine atoms and one fluorine atom attached to a benzene ring, along with an amino group (-NH2). This compound typically appears as a solid at room temperature and is known for its potential applications in the synthesis of dyes, pharmaceuticals, and agrochemicals. The presence of halogen substituents influences its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure contributes to its physical properties, such as solubility in organic solvents and varying degrees of stability under different conditions. Safety considerations are important when handling this substance, as aromatic amines can pose health risks, including potential carcinogenic effects. Proper safety protocols should be followed to minimize exposure. Overall, 2,6-Dichloro-4-fluorobenzenamine is a significant compound in organic chemistry with diverse applications.

Formula:C₆H₄Cl₂FN

InChI:InChI=1S/C6H4Cl2FN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2

InChI key:InChIKey=YAUYKCFMKMZTEX-UHFFFAOYSA-N

SMILES:FC=1C=C(Cl)C(N)=C(Cl)C1

Synonyms:
(2,6-Dichloro-4-fluorophenyl)amine
2,6-Dichloro-4-fluorobenzenamine
Aniline, 2,6-dichloro-4-fluoro-
Benzenamine, 2,6-Dichloro-4-Fluoro-
2,6-Dichloro-4-fluoroaniline

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2,6-DICHLORO-4-FLUOROANILINE REF: IN-DA00BYIMCAS: 344-19-4	98%	To inquire	Tue 15 Apr 25
2,6-Dichloro-4-fluoroaniline REF: 54-PC8181CAS: 344-19-4	97%	36.00 €~240.00 €	Wed 16 Apr 25
2,6-Dichloro-4-fluoroaniline REF: 3B-D3625CAS: 344-19-4	>97.0%(GC)(N)	39.00 €~109.00 €	Mon 21 Apr 25
2,6-Dichloro-4-fluoroaniline REF: 10-F013298CAS: 344-19-4	95.0%	To inquire	Fri 25 Apr 25
2,6-dichloro-4-fluoroaniline REF: 3D-FD105016CAS: 344-19-4	Min. 95%	143.00 €~447.00 €	Tue 10 Jun 25