CAS 3440-24-2
:3',4',7,8-Tetrahydroxyflavone
Description:
3',4',7,8-Tetrahydroxyflavone, also known as tetrahydroxyflavone, is a flavonoid compound characterized by its four hydroxyl (-OH) groups attached to the flavone backbone. This structure contributes to its antioxidant properties, making it of interest in various biological and pharmacological studies. The compound is typically found in certain plants and is associated with potential health benefits, including anti-inflammatory and anti-cancer activities. Its solubility can vary depending on the solvent, and it is generally more soluble in polar solvents due to the presence of hydroxyl groups. The compound's molecular structure allows it to interact with various biological targets, which is significant for its potential therapeutic applications. Additionally, 3',4',7,8-Tetrahydroxyflavone may exhibit UV-absorbing properties, which can be beneficial in protecting plant tissues from UV radiation. Overall, its unique chemical characteristics and biological activities make it a subject of interest in natural product chemistry and pharmacology.
Formula:C15H10O6
InChI:InChI=1/C15H10O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-6,16-17,19-20H
SMILES:c1cc(c(cc1c1cc(=O)c2ccc(c(c2o1)O)O)O)O
Synonyms:- 2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3',4',7,8-Tetrahydroxyflavone
CAS:3',4',7,8-Tetrahydroxyflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C15H10O6Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:286.253',4',7,8-Tetrahydroxyflavone
CAS:Formula:C15H10O6Purity:97%Color and Shape:SolidMolecular weight:286.23633',4',7,8-Tetrahydroxyflavone
CAS:3',4',7,8-Tetrahydroxyflavone is a natural product for research related to life sciences. The catalog number is TN2868 and the CAS number is 3440-24-2.Formula:C15H10O6Purity:98%Color and Shape:SolidMolecular weight:286.243',4',7,8-Tetrahydroxyflavone
CAS:3',4',7,8-Tetrahydroxyflavone is a polyhydroxyflavone compound, which is a type of flavonoid systematically derived from plant sources known for their rich polyphenolic content. It is characterized primarily by the presence of multiple hydroxyl groups that contribute to its significant biochemical activity. This compound exhibits its mode of action through the modulation of various biochemical pathways, primarily through its antioxidant properties that enable it to scavenge free radicals, thus reducing oxidative stress within biological systems.Formula:C15H10O6Purity:Min. 95%Color and Shape:Off-White Yellow PowderMolecular weight:286.24 g/mol3',4',7,8-Tetrahydroxyflavone
CAS:Controlled ProductStability Light Sensitive
Applications 3',4',7,8-Tetrahydroxyflavone (cas# 3440-24-2) is a useful research chemical.Formula:C15H10O6Color and Shape:Light YellowMolecular weight:286.24






