CAS 3440-99-1

5-(3-Bromophenyl)-2H-tetrazole

Description:

5-(3-Bromophenyl)-2H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the 3-bromophenyl group enhances its chemical reactivity and solubility properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may participate in nucleophilic substitution reactions due to the presence of the bromine atom, which can act as a leaving group. Additionally, tetrazoles are known for their ability to form hydrogen bonds, which can influence their interactions with biological targets. The compound's molecular structure contributes to its potential as a building block in the synthesis of more complex molecules. As with many brominated compounds, it is essential to handle 5-(3-Bromophenyl)-2H-tetrazole with care due to potential toxicity and environmental concerns associated with brominated organic compounds.

Formula: C₇H₅BrN₄

InChI: InChI=1S/C7H5BrN4/c8-6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12)

InChI key: InChIKey=UVKPUDRFBHSFJH-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1)C=2NN=NN2

Synonyms:

• 1H-Tetrazole, 5-(3-bromophenyl)-
• 2H-Tetrazole, 5-(3-bromophenyl)-
• 5-(3-bromophenyl)-2H-tetrazole
• 5-(m-Bromophenyl)tetrazole
• Tetrazole, 5-(m-bromophenyl)-

1H-Tetrazole, 5-(3-bromophenyl)-

CAS: 3440-99-1

Formula: C₇H₅BrN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.0454

Ref: IN-DA00I6SU

5-(3-BROMOPHENYL)-1H-TETRAZOLE

CAS: 3440-99-1

Formula: C₇H₅BrN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.049

Ref: 10-F501129

5-(3-Bromophenyl)-2H-tetrazole

CAS: 3440-99-1

5-(3-Bromophenyl)-2H-tetrazole is a chemical compound that can be used as a catalyst. It can be synthesized by the reaction of zinc oxide with organic compounds and is often used in the production of tetrazoles. 5-(3-Bromophenyl)-2H-tetrazole has been shown to work well as an oxidant, which makes it useful for various reactions involving organic synthesis and oxidation reactions.

Formula: C₇H₅BrN₄

Purity: Min. 95%

Molecular weight: 225.05 g/mol

Ref: 3D-FB51575

5-(3-Bromo-phenyl)-2H-tetrazole

CAS: 3440-99-1

5-(3-Bromo-phenyl)-2H-tetrazole

Purity: 95+%

Molecular weight: 225.05g/mol

Ref: 54-OR97516