CAS 3440-99-1: 5-(3-Bromophenyl)-2H-tetrazole
Description:5-(3-Bromophenyl)-2H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the 3-bromophenyl group enhances its chemical reactivity and solubility properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may participate in nucleophilic substitution reactions due to the presence of the bromine atom, which can act as a leaving group. Additionally, tetrazoles are known for their ability to form hydrogen bonds, which can influence their interactions with biological targets. The compound's molecular structure contributes to its potential as a building block in the synthesis of more complex molecules. As with many brominated compounds, it is essential to handle 5-(3-Bromophenyl)-2H-tetrazole with care due to potential toxicity and environmental concerns associated with brominated organic compounds.
Formula:C7H5BrN4
InChI:InChI=1S/C7H5BrN4/c8-6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12)
InChI key:InChIKey=UVKPUDRFBHSFJH-UHFFFAOYSA-N
SMILES:BrC1=CC=CC(=C1)C2=NN=NN2
- Synonyms:
- 1H-Tetrazole, 5-(3-bromophenyl)-
- 2H-Tetrazole, 5-(3-bromophenyl)-
- 5-(3-bromophenyl)-2H-tetrazole
- 5-(m-Bromophenyl)tetrazole
- Tetrazole, 5-(m-bromophenyl)-
1H-Tetrazole, 5-(3-bromophenyl)-
Ref: IN-DA00I6SU
| 1g | 61.00 € | ||
| 5g | 178.00 € | ||
| 10g | 229.00 € | ||
| 100mg | 30.00 € | ||
| 250mg | 45.00 € |
5-(3-BROMOPHENYL)-1H-TETRAZOLE
Ref: 10-F501129
| 1g | To inquire |
5-(3-Bromophenyl)-2H-tetrazole
Ref: 3D-FB51575
| 5g | 331.00 € | ||
| 10g | 447.00 € | ||
| 25g | 754.00 € | ||
| 50g | 1,184.00 € |
