CymitQuimica logo

CAS 34403-06-0

:

1-methyl-3-(2-phenylethyl)benzene

Description:
1-Methyl-3-(2-phenylethyl)benzene, also known as a substituted biphenyl compound, is characterized by its aromatic structure, which includes a methyl group and a phenylethyl substituent attached to a benzene ring. This compound typically exhibits a non-polar nature due to its hydrocarbon framework, making it relatively insoluble in water but soluble in organic solvents. Its molecular structure contributes to its potential applications in organic synthesis and as an intermediate in the production of various chemicals. The presence of the phenylethyl group can influence its reactivity and interactions with other molecules, potentially affecting its behavior in chemical reactions. Additionally, like many aromatic compounds, it may exhibit stability under standard conditions but can undergo electrophilic substitution reactions. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken. Overall, 1-methyl-3-(2-phenylethyl)benzene is an interesting compound within the realm of organic chemistry, with properties that can be explored for various applications.
Formula:C15H16
InChI:InChI=1/C15H16/c1-13-6-5-9-15(12-13)11-10-14-7-3-2-4-8-14/h2-9,12H,10-11H2,1H3
SMILES:Cc1cccc(CCc2ccccc2)c1
Synonyms:
  • Benzene, 1-methyl-3-(2-phenylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.