CAS 3441-00-7
:5-(3-Methylphenyl)-1H-tetrazole
Description:
5-(3-Methylphenyl)-1H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the 3-methylphenyl group contributes to its aromatic properties and influences its reactivity and solubility. This compound is typically a white to off-white solid and is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its tetrazole moiety is notable for its ability to form stable complexes with metals and its use in various chemical reactions, including as a precursor for more complex molecules. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Additionally, safety data should be consulted, as tetrazole derivatives can exhibit varying degrees of toxicity and reactivity. Overall, 5-(3-Methylphenyl)-1H-tetrazole is a versatile compound with significant relevance in chemical research and industry.
Formula:C8H8N4
InChI:InChI=1/C8H8N4/c1-6-3-2-4-7(5-6)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12)
SMILES:Cc1cccc(c1)c1n[nH]nn1
Synonyms:- 5-(m-Tolyl)-1H-tetrazole
- 5-(3-methylphenyl)-2H-tetrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-(3-Methylphenyl)-1H-tetrazole, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H8N4Purity:99%Molecular weight:160.185-(m-Tolyl)tetrazole
CAS:5-(m-Tolyl)tetrazole is an experimental compound that has been shown to be a nitrite reductase catalyst. It is also an electrochemical and photocatalytic oxidizing agent that can catalyze the oxidation of bromate. The crystal x-ray diffraction patterns of 5-(m-tolyl)tetrazole show the presence of channels, cycles, and nitrite ions in its structure.Formula:C8H8N4Purity:Min. 95%Molecular weight:160.18 g/mol




