CAS 3441-01-8
:3-Cyanobenzamide
Description:
3-Cyanobenzamide, with the CAS number 3441-01-8, is an organic compound characterized by the presence of both a cyanide group (-CN) and an amide group (-CONH2) attached to a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure features a cyano group positioned at the meta position relative to the amide group on the benzene ring, which influences its chemical reactivity and properties. 3-Cyanobenzamide is known for its potential applications in pharmaceuticals and organic synthesis, often serving as an intermediate in the production of various bioactive compounds. The presence of the cyano group can enhance the compound's reactivity, making it useful in nucleophilic substitution reactions. Additionally, the amide functionality contributes to hydrogen bonding capabilities, which can affect its solubility and interaction with biological systems. Overall, 3-Cyanobenzamide is a versatile compound with significant relevance in chemical research and development.
Formula:C8H6N2O
InChI:InChI=1S/C8H6N2O/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4H,(H2,10,11)
InChI key:InChIKey=PAQVSWFCADWSLB-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(C#N)=CC=C1
Synonyms:- 3-Cyano-benzamide
- Benzamide, 3-Cyano-
- Benzamide, m-cyano-
- m-Cyanobenzamide
- 3-Cyanobenzamide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
m-Cyanobenzamide
CAS:m-CyanobenzamideFormula:C8H6N2OPurity:97%Color and Shape:SolidMolecular weight:146.146043-Cyanobenzamide
CAS:3-Cyanobenzamide is an organic compound with the formula CHC(N)NH. It is a white crystalline solid that can be obtained by reacting benzamide with cyanoacetylene. There are three possible isomers of 3-cyanobenzamide: 3-cyano-1-(substituted phenyl)benzamide, 3-cyano-2-(substituted phenyl)benzamide, and 3-cyano-3-(substituted phenyl)benzamide. The optimal reaction conditions for the synthesis of 3-cyanobenzamide are in the presence of hydrogen bonding, such as n-hexane, amide, and phase equilibrium. Studies have determined that 3-cyanobenzamide has the potential to cause cancer or liver toxicity in humans. In addition, this chemical has been shown to be an effective inhibitor of alpha glucosidase enzymes in vitro and in vivo.Formula:C8H6N2OPurity:Min. 90%Molecular weight:146.15 g/mol




