CymitQuimica logo

CAS 3441-03-0

:

methyl 3-(chlorocarbonyl)benzoate

Description:
Methyl 3-(chlorocarbonyl)benzoate, with the CAS number 3441-03-0, is an organic compound that belongs to the class of benzoate esters. It features a benzoate moiety where a methyl group is esterified to the carboxylic acid, and it contains a chlorocarbonyl group at the meta position relative to the ester functionality. This compound is typically characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the chlorocarbonyl group introduces electrophilic characteristics, making it a potential intermediate in various chemical reactions, including acylation and nucleophilic substitution. Methyl 3-(chlorocarbonyl)benzoate is generally a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle this compound with care due to its reactive chlorocarbonyl group, which can pose hazards such as toxicity and reactivity with nucleophiles. Its applications may include use in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals.
Formula:C9H7ClO3
InChI:InChI=1/C9H7ClO3/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3
InChI key:UTGGIQHJOAPIPD-UHFFFAOYSA-N
SMILES:COC(=O)c1cccc(c1)C(=O)Cl
Found 4 products.