CAS 34420-17-2
:2-Phenylethyl-1-boronic acid
Description:
2-Phenylethyl-1-boronic acid, with the CAS number 34420-17-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenylethyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as methanol and ethanol, while being less soluble in non-polar solvents. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, 2-phenylethyl-1-boronic acid can act as a ligand in coordination chemistry and has potential applications in drug development due to its ability to interact with biological molecules. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a reaction environment.
Formula:C8H9BO2
InChI:InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+
Synonyms:- Phenethylboronic acid
- (2-Phenylethyl)Boronic Acid
- [(E)-2-phenylethenyl]boronic acid
- 2-Phenylethaneboronic acid
- Phenylethaneboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Phenylethylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO2Color and Shape:White to Almost white powder to crystalMolecular weight:149.982-Phenylethylboronic acid
CAS:2-Phenylethylboronic acidFormula:C8H11BO2Purity:98%Color and Shape: white crystalline solidMolecular weight:149.98g/mol2-Phenyl-1-ethylboronic acid
CAS:Formula:C8H11BO2Purity:95%Color and Shape:SolidMolecular weight:149.98



