CAS 34421-99-3

1,2,3,5,6,7-Hexahydrodicyclopenta[b,e]pyridine

Description:

1,2,3,5,6,7-Hexahydrodicyclopenta[b,e]pyridine, with CAS number 34421-99-3, is a bicyclic organic compound characterized by its unique polycyclic structure. It features a nitrogen atom incorporated into a fused ring system, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the nitrogen atom in its structure can impart basicity and influence its reactivity, making it a subject of interest in medicinal chemistry. Additionally, its hydrophobic nature may affect its solubility in different solvents, which is an important consideration in its practical applications. Overall, 1,2,3,5,6,7-Hexahydrodicyclopenta[b,e]pyridine is notable for its complex structure and potential utility in various chemical processes.

Formula: C₁₁H₁₃N

InChI: InChI=1S/C11H13N/c1-3-8-7-9-4-2-6-11(9)12-10(8)5-1/h7H,1-6H2

InChI key: InChIKey=WFEKFUDZCWEZQO-UHFFFAOYSA-N

SMILES: C=12C(=NC3=C(C1)CCC3)CCC2

Synonyms:

• 1,2,3,5,6,7-Hexahydrodicyclopenta(b,e)pyridine
• Dicyclopenta[b,e]pyridine, 1,2,3,5,6,7-hexahydro-
• 1,2,3,5,6,7-Hexahydrodicyclopenta[b,e]pyridine

2-Azatricyclo[7.3.0.0,3,7]dodeca-1,3(7),8-triene

CAS: 34421-99-3

2-Azatricyclo[7.3.0.0,3,7]dodeca-1,3(7),8-triene is a mesoporous material with three dimensional channels that can adsorb molecules such as formaldehyde and pyridine. The zeolites in this material have been shown to catalyze the conversion of formaldehyde to methanol by reacting with a transition metal ion and a thioamide. This material has also been shown to be able to adsorb metal ions such as copper and zinc from solutions using its porous structure. 2-Azatricyclo[7.3.0.0,3,7]dodeca-1,3(7),8-triene can be used as a catalyst for the removal of toxic substances from water or air, or as a selective adsorbent for the separation of metal ions in industrial processes.

Formula: C₁₁H₁₃N

Purity: Min. 95%

Molecular weight: 159.23 g/mol

Ref: 3D-JBA42199