CAS 344298-86-8

1-Butan-1,1,2,2,3,3,4,4,4-d9-amine, hydrochloride

Description:

1-Butan-1,1,2,2,3,3,4,4,4-d9-amine, hydrochloride, is a deuterated amine compound characterized by the presence of deuterium atoms, which are isotopes of hydrogen. This specific compound features a butyl chain with multiple deuterated positions, making it useful in various applications, particularly in research involving isotopic labeling. The hydrochloride form indicates that the amine is protonated, enhancing its solubility in water and making it suitable for biological and chemical studies. As an amine, it exhibits basic properties and can participate in various chemical reactions, including nucleophilic substitutions and the formation of salts. Its unique isotopic composition allows for advanced analytical techniques, such as NMR spectroscopy, to trace metabolic pathways or study reaction mechanisms. Overall, this compound serves as a valuable tool in both synthetic chemistry and pharmacological research, providing insights into molecular behavior and interactions.

Formula: C₄H₂D₉N·ClH

InChI: InChI=1S/C4H11N.ClH/c1-2-3-4-5;/h2-5H2,1H3;1H/i1D3,2D2,3D2,4D2;

InChI key: InChIKey=ICXXXLGATNSZAV-SRKCJUICSA-N

SMILES: C(C(C([2H])([2H])[2H])([2H])[2H])(C(N)([2H])[2H])([2H])[2H].Cl

Synonyms:

• 1-Butan-1,1,2,2,3,3,4,4,4-d₉-amine, hydrochloride
• N-Butyl-D9-Amine Hcl
• N-Butyl-D9-Amine Hydrochloride
• 1-Butan-1,1,2,2,3,3,4,4,4-d9-amine, hydrochloride

n-Butyl-d9-amine HCl

CAS: 344298-86-8

Formula: CD₃CD₂CD₂CD₂NH₂HCl

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 118.12232

Ref: 3U-D2542

n-Butyl-d9-amine HCl

Controlled Product

CAS: 344298-86-8

Applications n-Butyl-d9-amine HCl (CAS# 344298-86-8) is a useful isotopically labeled research compound.

Formula: C₄D₉H₂N·ClH

Color and Shape: Neat

Molecular weight: 118.65

Ref: TR-B693121