CAS 344299-45-2

Benzeneacetic-d2 acid, 3,4,5-trimethoxy-

Description:

Benzeneacetic-d2 acid, 3,4,5-trimethoxy- is a chemical compound characterized by its aromatic structure and the presence of multiple methoxy groups. The "d2" designation indicates that the compound contains deuterium, a stable isotope of hydrogen, which can be used in various applications, including NMR spectroscopy for tracing and studying molecular interactions. The presence of three methoxy groups at the 3, 4, and 5 positions on the benzene ring contributes to the compound's unique electronic properties and solubility characteristics. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and pharmacology. Its CAS number, 344299-45-2, allows for precise identification in chemical databases and literature. Overall, the combination of its functional groups and isotopic labeling makes Benzeneacetic-d2 acid, 3,4,5-trimethoxy- a valuable compound for research and potential applications in various fields of chemistry and biochemistry.

Formula: C₁₁H₁₂D₂O₅

InChI: InChI=1S/C11H14O5/c1-14-8-4-7(6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H,12,13)/i6D2

InChI key: InChIKey=DDSJXCGGOXKGSJ-NCYHJHSESA-N

SMILES: O(C)C1=C(OC)C(OC)=CC(C(C(O)=O)([2H])[2H])=C1

Synonyms:

• 3,4,5-Trimethoxyphenylacetic-2,2-D2 Acid
• Benzeneacetic-d₂ acid, 3,4,5-trimethoxy-
• Benzeneacetic-d2 acid, 3,4,5-trimethoxy-

3,4,5-Trimethoxyphenylacetic-2,2-d2 Acid

CAS: 344299-45-2

Formula: (CH₃O)₃C₆H₂CD₂COOH

Purity: 97 atom % D

Color and Shape: White Solid

Molecular weight: 228.09668

Ref: 3U-D2144

(3,4,5-Trimethoxyphenyl)acetic-α,α-d2 Acid

Controlled Product

CAS: 344299-45-2

Applications (3,4,5-Trimethoxyphenyl)acetic-alpha,alpha-d2 Acid (CAS# 344299-45-2) is a useful isotopically labeled research compound.

Formula: C₁₁H₁₂D₂O₅

Color and Shape: Neat

Molecular weight: 228.24

Ref: TR-T795476