CAS 3443-45-6: 1-Pyrenebutanoic acid
Description:1-Pyrenebutanoic acid is an organic compound characterized by its pyrene moiety, which is a polycyclic aromatic hydrocarbon, linked to a butanoic acid functional group. This compound typically appears as a solid at room temperature and is known for its fluorescence properties, making it useful in various applications, including as a fluorescent probe in biochemical studies. The presence of the butanoic acid group imparts hydrophilicity, enhancing its solubility in polar solvents compared to its parent pyrene structure. 1-Pyrenebutanoic acid can participate in various chemical reactions, including esterification and amidation, due to its carboxylic acid functionality. Its unique structure allows it to interact with biological systems, making it a candidate for studies in drug delivery and cellular imaging. Additionally, it may exhibit photophysical properties that are influenced by its environment, which is valuable in the development of sensors and materials in nanotechnology. Overall, 1-pyrenebutanoic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C20H16O2
InChI:InChI=1S/C20H16O2/c21-18(22)6-2-3-13-7-8-16-10-9-14-4-1-5-15-11-12-17(13)20(16)19(14)15/h1,4-5,7-12H,2-3,6H2,(H,21,22)
InChI key:InChIKey=QXYRRCOJHNZVDJ-UHFFFAOYSA-N
SMILES:O=C(O)CCCC1=CC=C2C=CC3=CC=CC=4C=CC1=C2C34
- Synonyms:
- 1-Pyrenebutanoic acid
- 1-Pyrenebutyrate
- 1-Pyrenebutyric acid
- 1-Pyrenylbutyric acid
- 2-(Pyren-1-Yl)Butanoic Acid
- 4-(1-Pyrene)butanoic acid
- 4-(1-Pyrene)butyric acid
- 4-(1-Pyrenyl)butanoic acid
- 4-(1-Pyrenyl)butyric acid
- 4-(Pyren-1-Yl)Butanoic Acid
- See more synonyms
- Nsc 30833
- Pyrene-3-butyric acid
- gamma-(3-Pyrenyl)butyric acid
- γ-(3-Pyrenyl)butyric acid
- Pyrene-1-butyric acid
