CAS 344331-90-4

6-Bromo-2-tert-butoxycarbonylaminopyridine

Description:

6-Bromo-2-tert-butoxycarbonylaminopyridine is a chemical compound characterized by its unique structure, which includes a bromine atom and a tert-butoxycarbonyl (Boc) protecting group attached to a pyridine ring. This compound typically appears as a solid and is soluble in organic solvents, making it useful in various synthetic applications. The presence of the bromine atom enhances its reactivity, allowing for further functionalization in organic synthesis. The Boc group serves as a protective moiety for the amine functionality, facilitating selective reactions without affecting the amine during synthetic processes. This compound is often utilized in medicinal chemistry and drug development, particularly in the synthesis of biologically active molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions under which it is handled. As with many chemical substances, proper safety precautions should be observed when working with 6-Bromo-2-tert-butoxycarbonylaminopyridine, including the use of personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₀H₁₃BrN₂O₂

InChI: InChI=1/C10H13BrN2O2/c1-10(2,3)15-9(14)13-8-6-4-5-7(11)12-8/h4-6H,1-3H3,(H,12,13,14)

SMILES: CC(C)(C)OC(=Nc1cccc(Br)n1)O

Synonyms:

• tert-Butyl 6-bromopyridin-2-ylcarbamate

N-Boc-2-Amino-6-bromopyridine

CAS: 344331-90-4

Formula: C₁₀H₁₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 273.1264

Ref: IN-DA003EZS

2-(Boc-Amino)-6-bromopyridine

CAS: 344331-90-4

2-(Boc-Amino)-6-bromopyridine

Purity: 99%

Color and Shape: Solid

Molecular weight: 273.13g/mol

Ref: 54-OR959588

tert-Butyl 6-Bromopyridin-2-ylcarbamate

CAS: 344331-90-4

Formula: C₁₀H₁₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 273.13

Ref: 10-F064827