CAS 34446-11-2

Methyleneglycolbisdibromopropylether

Description:

Methyleneglycolbisdibromopropylether, with the CAS number 34446-11-2, is a chemical compound that belongs to the class of ethers. It is characterized by the presence of two dibromopropyl groups attached to a methyleneglycol backbone. This structure imparts specific properties, such as increased reactivity due to the bromine substituents, which can participate in various chemical reactions, including nucleophilic substitutions. The compound is typically used in industrial applications, particularly in the synthesis of polymers and as a potential intermediate in organic synthesis. It may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Additionally, it is important to consider its environmental impact, as halogenated compounds can pose risks to aquatic life and ecosystems. Overall, Methyleneglycolbisdibromopropylether is a specialized chemical with unique properties that make it valuable in certain chemical processes, while also requiring responsible management due to its potential hazards.

Formula: C₇H₁₂Br₄O₂

InChI: InChI=1/C7H12Br4O2/c8-1-6(10)3-12-5-13-4-7(11)2-9/h6-7H,1-5H2

SMILES: C(C(COCOCC(CBr)Br)Br)Br

Synonyms:

• Methylene glycol bis(2,3-dibromopropyl)ether

Methylene Glycol Bis(2,3-dibromopropyl) Ether

CAS: 34446-11-2

Formula: C₇H₁₂Br₄O₂

Purity: >70.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 447.79

Ref: 3B-M0313

Methyleneglycolbis(2,3-dibromopropyl)ether

CAS: 34446-11-2

Formula: C₇H₁₂Br₄O₂

Molecular weight: 447.7850

Ref: IN-DA003S3S