CAS 344566-78-5

tert-butyl [1-(4-cyanophenyl)piperidin-4-yl]carbamate

Description:

Tert-butyl [1-(4-cyanophenyl)piperidin-4-yl]carbamate, identified by its CAS number 344566-78-5, is a chemical compound that belongs to the class of carbamates. This substance features a tert-butyl group, which contributes to its hydrophobic characteristics, enhancing its solubility in organic solvents. The presence of a piperidine ring provides a cyclic amine structure, which is often associated with biological activity, while the 4-cyanophenyl moiety introduces a nitrile functional group that can influence the compound's electronic properties and reactivity. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the combination of its lipophilicity and the presence of functional groups that can engage in hydrogen bonding and other interactions. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tert-butyl group, making it a subject of interest in synthetic organic chemistry and drug design.

Formula: C₁₇H₂₃N₃O₂

InChI: InChI=1/C17H23N3O2/c1-17(2,3)22-16(21)19-14-8-10-20(11-9-14)15-6-4-13(12-18)5-7-15/h4-7,14H,8-11H2,1-3H3,(H,19,21)

SMILES: CC(C)(C)OC(=NC1CCN(CC1)c1ccc(cc1)C#N)O

Synonyms:

• Tert-butyl N-[1-(4-cyanophenyl)-4-piperidinyl] carbamate

tert-Butyl N-[1-(4-cyanophenyl)piperidin-4-yl]carbamate

CAS: 344566-78-5

Versatile small molecule scaffold

Formula: C₁₇H₂₃N₃O₂

Purity: Min. 95%

Molecular weight: 301.4 g/mol

Ref: 3D-UNA56678